ChemNet > CAS > 342411-14-7 2,1,3-benzothiadiazol-4-yl isocyanate
342411-14-7 2,1,3-benzothiadiazol-4-yl isocyanate
| product Name |
2,1,3-benzothiadiazol-4-yl isocyanate |
| Synonyms |
4-isocyanato-2,1,3-benzothiadiazole |
| Molecular Formula |
C7H3N3OS |
| Molecular Weight |
177.1832 |
| InChI |
InChI=1/C7H3N3OS/c11-4-8-5-2-1-3-6-7(5)10-12-9-6/h1-3H |
| CAS Registry Number |
342411-14-7 |
| Molecular Structure |
|
| Density |
1.55g/cm3 |
| Melting point |
77℃ |
| Boiling point |
268.1°C at 760 mmHg |
| Refractive index |
1.772 |
| Flash point |
115.9°C |
| Vapour Pressur |
0.00786mmHg at 25°C |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
